C8H10Cl2O — CID 14127271
(1R,6S,7S)-8,8-dichlorobicyclo[4.2.0]oct-2-en-7-ol (PubChem CID 14127271) has the molecular formula C8H10Cl2O and a molecular weight of 193.07 g/mol. Its IUPAC name is (1R,6S,7S)-8,8-dichlorobicyclo[4.2.0]oct-2-en-7-ol.
| Compound Name | (1R,6S,7S)-8,8-dichlorobicyclo[4.2.0]oct-2-en-7-ol |
|---|---|
| PubChem CID | 14127271 |
| Molecular Formula | C8H10Cl2O |
| Molecular Weight | 193.07 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | (1R,6S,7S)-8,8-dichlorobicyclo[4.2.0]oct-2-en-7-ol |
| SMILES | O[C@H]1[C@H]2CCC=C[C@H]2C1(Cl)Cl |
| InChI | InChI=1S/C8H10Cl2O/c9-8(10)6-4-2-1-3-5(6)7(8)11/h2,4-7,11H,1,3H2/t5-,6+,7-/m0/s1 |
| InChIKey | JWKPCYKHRDJOPU-XVMARJQXSA-N |
| XLogP | 2.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.07 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|