About 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride
8-N,3-dimethylphenazine-2,8-diamine;hydrochloride (PubChem CID 141272932) has the molecular formula C14H15ClN4
and a molecular weight of 274.76 g/mol. Its IUPAC name is 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride.
Molecular Properties
| Compound Name | 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride |
| PubChem CID | 141272932 |
| Molecular Formula | C14H15ClN4 |
| Molecular Weight | 274.76 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride |
| SMILES | CNc1ccc2nc3cc(C)c(N)cc3nc2c1.Cl |
| InChI | InChI=1S/C14H14N4.ClH/c1-8-5-12-14(7-10(8)15)18-13-6-9(16-2)3-4-11(13)17-12;/h3-7,16H,15H2,1-2H3;1H |
| InChIKey | BYTAPOJQCXUXKH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride?
The IUPAC name of 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride (CID 141272932) is 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride.
What is the SMILES notation for 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride?
The canonical SMILES for 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride is CNc1ccc2nc3cc(C)c(N)cc3nc2c1.Cl.
What is the InChIKey of 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride?
The InChIKey is BYTAPOJQCXUXKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4.ClH/c1-8-5-12-14(7-10(8)15)18-13-6-9(16-2)3-4-11(13)17-12;/h3-7,16H,15H2,1-2H3;1H.
What are the key properties of 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride?
8-N,3-dimethylphenazine-2,8-diamine;hydrochloride has a molecular weight of 274.76 g/mol, XLogP of 3.14, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N,3-dimethylphenazine-2,8-diamine;hydrochloride is sourced from PubChem (CID 141272932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).