C24H24FNO2 — CID 141273330
(2S,3R,4R,5S)-1-(4-fluorophenyl)-3,4-dimethoxy-2,5-diphenylpyrrolidine (PubChem CID 141273330) has the molecular formula C24H24FNO2 and a molecular weight of 377.46 g/mol. Its IUPAC name is (2S,3R,4R,5S)-1-(4-fluorophenyl)-3,4-dimethoxy-2,5-diphenylpyrrolidine.
| Compound Name | (2S,3R,4R,5S)-1-(4-fluorophenyl)-3,4-dimethoxy-2,5-diphenylpyrrolidine |
|---|---|
| PubChem CID | 141273330 |
| Molecular Formula | C24H24FNO2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (2S,3R,4R,5S)-1-(4-fluorophenyl)-3,4-dimethoxy-2,5-diphenylpyrrolidine |
| SMILES | CO[C@H]1[C@H](OC)[C@H](c2ccccc2)N(c2ccc(F)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H24FNO2/c1-27-23-21(17-9-5-3-6-10-17)26(20-15-13-19(25)14-16-20)22(24(23)28-2)18-11-7-4-8-12-18/h3-16,21-24H,1-2H3/t21-,22-,23+,24+/m0/s1 |
| InChIKey | LRICBEDVYMRXOG-CJRSTVEYSA-N |
| XLogP | 5.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |