C17H23NO4 — CID 141273645
(4aS,10aS)-6,7-dihydroxy-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline-2-carboxylic acid (PubChem CID 141273645) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (4aS,10aS)-6,7-dihydroxy-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline-2-carboxylic acid.
| Compound Name | (4aS,10aS)-6,7-dihydroxy-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 141273645 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (4aS,10aS)-6,7-dihydroxy-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinoline-2-carboxylic acid |
| SMILES | CCCN1C(C(=O)O)CC[C@H]2Cc3c(ccc(O)c3O)C[C@@H]21 |
| InChI | InChI=1S/C17H23NO4/c1-2-7-18-13(17(21)22)5-3-11-8-12-10(9-14(11)18)4-6-15(19)16(12)20/h4,6,11,13-14,19-20H,2-3,5,7-9H2,1H3,(H,21,22)/t11-,13?,14-/m0/s1 |
| InChIKey | YWGQLBYJDWDOCL-UFPXDFCQSA-N |
| XLogP | 2.14 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|