C14H17NO4 — CID 141274739
2-(2-methyl-1,3-dioxo-7,7a-dihydro-6H-isoindol-3a-yl)ethyl prop-2-enoate (PubChem CID 141274739) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dioxo-7,7a-dihydro-6H-isoindol-3a-yl)ethyl prop-2-enoate.
| Compound Name | 2-(2-methyl-1,3-dioxo-7,7a-dihydro-6H-isoindol-3a-yl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 141274739 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-(2-methyl-1,3-dioxo-7,7a-dihydro-6H-isoindol-3a-yl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC12C=CCCC1C(=O)N(C)C2=O |
| InChI | InChI=1S/C14H17NO4/c1-3-11(16)19-9-8-14-7-5-4-6-10(14)12(17)15(2)13(14)18/h3,5,7,10H,1,4,6,8-9H2,2H3 |
| InChIKey | FZVUQNBALWVRRT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|