About 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide
4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide (PubChem CID 14127490) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide.
Molecular Properties
| Compound Name | 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide |
| PubChem CID | 14127490 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide |
| SMILES | CN(C)C(=O)c1cc(N)c2ccccc2c1O |
| InChI | InChI=1S/C13H14N2O2/c1-15(2)13(17)10-7-11(14)8-5-3-4-6-9(8)12(10)16/h3-7,16H,14H2,1-2H3 |
| InChIKey | KJIBJKDTICVZGG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide?
The IUPAC name of 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide (CID 14127490) is 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide.
What is the SMILES notation for 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide?
The canonical SMILES for 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide is CN(C)C(=O)c1cc(N)c2ccccc2c1O.
What is the InChIKey of 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide?
The InChIKey is KJIBJKDTICVZGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-15(2)13(17)10-7-11(14)8-5-3-4-6-9(8)12(10)16/h3-7,16H,14H2,1-2H3.
What are the key properties of 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide?
4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide has a molecular weight of 230.27 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-hydroxy-N,N-dimethylnaphthalene-2-carboxamide is sourced from PubChem (CID 14127490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).