About 3-cyclohexyl-1,6-dihydropyrimidin-2-one
3-cyclohexyl-1,6-dihydropyrimidin-2-one (PubChem CID 141275058) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-cyclohexyl-1,6-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 3-cyclohexyl-1,6-dihydropyrimidin-2-one |
| PubChem CID | 141275058 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-cyclohexyl-1,6-dihydropyrimidin-2-one |
| SMILES | O=C1NCC=CN1C1CCCCC1 |
| InChI | InChI=1S/C10H16N2O/c13-10-11-7-4-8-12(10)9-5-2-1-3-6-9/h4,8-9H,1-3,5-7H2,(H,11,13) |
| InChIKey | PHBLNVYBIOJMDM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexyl-1,6-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1,6-dihydropyrimidin-2-one?
The IUPAC name of 3-cyclohexyl-1,6-dihydropyrimidin-2-one (CID 141275058) is 3-cyclohexyl-1,6-dihydropyrimidin-2-one.
What is the SMILES notation for 3-cyclohexyl-1,6-dihydropyrimidin-2-one?
The canonical SMILES for 3-cyclohexyl-1,6-dihydropyrimidin-2-one is O=C1NCC=CN1C1CCCCC1.
What is the InChIKey of 3-cyclohexyl-1,6-dihydropyrimidin-2-one?
The InChIKey is PHBLNVYBIOJMDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c13-10-11-7-4-8-12(10)9-5-2-1-3-6-9/h4,8-9H,1-3,5-7H2,(H,11,13).
What are the key properties of 3-cyclohexyl-1,6-dihydropyrimidin-2-one?
3-cyclohexyl-1,6-dihydropyrimidin-2-one has a molecular weight of 180.25 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1,6-dihydropyrimidin-2-one is sourced from PubChem (CID 141275058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).