C23H21N3O8S — CID 14127527
(4-nitrophenyl)methyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[4-(methylcarbamoyl)phenoxy]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 14127527) has the molecular formula C23H21N3O8S and a molecular weight of 499.50 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[4-(methylcarbamoyl)phenoxy]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[4-(methylcarbamoyl)phenoxy]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 14127527 |
| Molecular Formula | C23H21N3O8S |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[4-(methylcarbamoyl)phenoxy]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CNC(=O)c1ccc(OC2=C(C(=O)OCc3ccc([N+](=O)[O-])cc3)N3C(=O)[C@H]([C@@H](C)O)[C@H]3S2)cc1 |
| InChI | InChI=1S/C23H21N3O8S/c1-12(27)17-20(29)25-18(22(30)33-11-13-3-7-15(8-4-13)26(31)32)23(35-21(17)25)34-16-9-5-14(6-10-16)19(28)24-2/h3-10,12,17,21,27H,11H2,1-2H3,(H,24,28)/t12-,17+,21-/m1/s1 |
| InChIKey | ZZIMEYZTZPVJCV-LGZJRCCHSA-N |
| XLogP | 2.16 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|