C27H20Cl2O — CID 141275371
1,3-bis[4-(4-chlorophenyl)phenyl]propan-2-one (PubChem CID 141275371) has the molecular formula C27H20Cl2O and a molecular weight of 431.36 g/mol. Its IUPAC name is 1,3-bis[4-(4-chlorophenyl)phenyl]propan-2-one.
| Compound Name | 1,3-bis[4-(4-chlorophenyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 141275371 |
| Molecular Formula | C27H20Cl2O |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1,3-bis[4-(4-chlorophenyl)phenyl]propan-2-one |
| SMILES | O=C(Cc1ccc(-c2ccc(Cl)cc2)cc1)Cc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H20Cl2O/c28-25-13-9-23(10-14-25)21-5-1-19(2-6-21)17-27(30)18-20-3-7-22(8-4-20)24-11-15-26(29)16-12-24/h1-16H,17-18H2 |
| InChIKey | KPLJRGUEFUNFME-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |