C17H36O2S3 — CID 141275399
2,2,12,12-tetramethyl-3,7,11-tris(sulfanyl)tridecane-5,9-diol (PubChem CID 141275399) has the molecular formula C17H36O2S3 and a molecular weight of 368.67 g/mol. Its IUPAC name is 2,2,12,12-tetramethyl-3,7,11-tris(sulfanyl)tridecane-5,9-diol.
| Compound Name | 2,2,12,12-tetramethyl-3,7,11-tris(sulfanyl)tridecane-5,9-diol |
|---|---|
| PubChem CID | 141275399 |
| Molecular Formula | C17H36O2S3 |
| Molecular Weight | 368.67 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2,2,12,12-tetramethyl-3,7,11-tris(sulfanyl)tridecane-5,9-diol |
| SMILES | CC(C)(C)C(S)CC(O)CC(S)CC(O)CC(S)C(C)(C)C |
| InChI | InChI=1S/C17H36O2S3/c1-16(2,3)14(21)9-11(18)7-13(20)8-12(19)10-15(22)17(4,5)6/h11-15,18-22H,7-10H2,1-6H3 |
| InChIKey | MHFQWQUQWXJZFU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|