About N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide
N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide (PubChem CID 141275723) has the molecular formula C20H25NO2S
and a molecular weight of 343.49 g/mol. Its IUPAC name is N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide.
Molecular Properties
| Compound Name | N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide |
| PubChem CID | 141275723 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)N(C)C1CCc2cc(Cc3ccccc3)ccc21 |
| InChI | InChI=1S/C20H25NO2S/c1-15(2)24(22,23)21(3)20-12-10-18-14-17(9-11-19(18)20)13-16-7-5-4-6-8-16/h4-9,11,14-15,20H,10,12-13H2,1-3H3 |
| InChIKey | ZEXRRFJNHGGXSA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide?
The IUPAC name of N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide (CID 141275723) is N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide.
What is the SMILES notation for N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide?
The canonical SMILES for N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide is CC(C)S(=O)(=O)N(C)C1CCc2cc(Cc3ccccc3)ccc21.
What is the InChIKey of N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide?
The InChIKey is ZEXRRFJNHGGXSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO2S/c1-15(2)24(22,23)21(3)20-12-10-18-14-17(9-11-19(18)20)13-16-7-5-4-6-8-16/h4-9,11,14-15,20H,10,12-13H2,1-3H3.
What are the key properties of N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide?
N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide has a molecular weight of 343.49 g/mol, XLogP of 3.93, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-benzyl-2,3-dihydro-1H-inden-1-yl)-N-methylpropane-2-sulfonamide is sourced from PubChem (CID 141275723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).