C22H13F5N2O3S — CID 14127659
2,3,4,5,6-pentafluoro-N-[4-(quinolin-2-ylmethoxy)phenyl]benzenesulfonamide (PubChem CID 14127659) has the molecular formula C22H13F5N2O3S and a molecular weight of 480.41 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-(quinolin-2-ylmethoxy)phenyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-(quinolin-2-ylmethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 14127659 |
| Molecular Formula | C22H13F5N2O3S |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-(quinolin-2-ylmethoxy)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(OCc2ccc3ccccc3n2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H13F5N2O3S/c23-17-18(24)20(26)22(21(27)19(17)25)33(30,31)29-13-7-9-15(10-8-13)32-11-14-6-5-12-3-1-2-4-16(12)28-14/h1-10,29H,11H2 |
| InChIKey | YMACPEKJVIUZFU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|