C20H24BrN3O5 — CID 141276986
[4-[(6-bromo-3-nitroquinolin-4-yl)amino]cyclohexyl] tert-butyl carbonate (PubChem CID 141276986) has the molecular formula C20H24BrN3O5 and a molecular weight of 466.33 g/mol. Its IUPAC name is [4-[(6-bromo-3-nitroquinolin-4-yl)amino]cyclohexyl] tert-butyl carbonate.
| Compound Name | [4-[(6-bromo-3-nitroquinolin-4-yl)amino]cyclohexyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 141276986 |
| Molecular Formula | C20H24BrN3O5 |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | [4-[(6-bromo-3-nitroquinolin-4-yl)amino]cyclohexyl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC1CCC(Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C20H24BrN3O5/c1-20(2,3)29-19(25)28-14-7-5-13(6-8-14)23-18-15-10-12(21)4-9-16(15)22-11-17(18)24(26)27/h4,9-11,13-14H,5-8H2,1-3H3,(H,22,23) |
| InChIKey | GLAYCWBVASQXIF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|