C19H34O4 — CID 14127781
propan-2-yl (2E,4E)-10-hydroxy-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate (PubChem CID 14127781) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is propan-2-yl (2E,4E)-10-hydroxy-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate.
| Compound Name | propan-2-yl (2E,4E)-10-hydroxy-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 14127781 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | propan-2-yl (2E,4E)-10-hydroxy-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
| SMILES | COC(C)(C)C(O)CCC(C)C/C=C/C(C)=C/C(=O)OC(C)C |
| InChI | InChI=1S/C19H34O4/c1-14(2)23-18(21)13-16(4)10-8-9-15(3)11-12-17(20)19(5,6)22-7/h8,10,13-15,17,20H,9,11-12H2,1-7H3/b10-8+,16-13+ |
| InChIKey | AZTBGOWEAIBOCC-ZQHUEGGHSA-N |
| XLogP | 4.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|