C17H9Cl2FN4S — CID 141277951
4-[4-(2,4-dichlorophenyl)-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-fluoropyridine (PubChem CID 141277951) has the molecular formula C17H9Cl2FN4S and a molecular weight of 391.26 g/mol. Its IUPAC name is 4-[4-(2,4-dichlorophenyl)-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-fluoropyridine.
| Compound Name | 4-[4-(2,4-dichlorophenyl)-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-fluoropyridine |
|---|---|
| PubChem CID | 141277951 |
| Molecular Formula | C17H9Cl2FN4S |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 4-[4-(2,4-dichlorophenyl)-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-fluoropyridine |
| SMILES | Fc1cc(-c2cc(-c3ccc(Cl)cc3Cl)c(-c3ncn[nH]3)s2)ccn1 |
| InChI | InChI=1S/C17H9Cl2FN4S/c18-10-1-2-11(13(19)6-10)12-7-14(9-3-4-21-15(20)5-9)25-16(12)17-22-8-23-24-17/h1-8H,(H,22,23,24) |
| InChIKey | SWCIFZLNFFLEBK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|