C13H19N5O — CID 141278198
1-[(3S,4S)-4-amino-1-pyrimidin-2-ylpyrrolidin-3-yl]piperidin-2-one (PubChem CID 141278198) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 1-[(3S,4S)-4-amino-1-pyrimidin-2-ylpyrrolidin-3-yl]piperidin-2-one.
| Compound Name | 1-[(3S,4S)-4-amino-1-pyrimidin-2-ylpyrrolidin-3-yl]piperidin-2-one |
|---|---|
| PubChem CID | 141278198 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 1-[(3S,4S)-4-amino-1-pyrimidin-2-ylpyrrolidin-3-yl]piperidin-2-one |
| SMILES | N[C@H]1CN(c2ncccn2)C[C@@H]1N1CCCCC1=O |
| InChI | InChI=1S/C13H19N5O/c14-10-8-17(13-15-5-3-6-16-13)9-11(10)18-7-2-1-4-12(18)19/h3,5-6,10-11H,1-2,4,7-9,14H2/t10-,11-/m0/s1 |
| InChIKey | BDTHXXKBIXUJEA-QWRGUYRKSA-N |
| XLogP | 0.00 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |