C11H9ClF3N3OS — CID 14127915
N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]-2,2,2-trifluoroacetamide (PubChem CID 14127915) has the molecular formula C11H9ClF3N3OS and a molecular weight of 323.73 g/mol. Its IUPAC name is N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 14127915 |
| Molecular Formula | C11H9ClF3N3OS |
| Molecular Weight | 323.73 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | N-[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]-2,2,2-trifluoroacetamide |
| SMILES | O=C(/N=C1\SCCN1Cc1ccc(Cl)nc1)C(F)(F)F |
| InChI | InChI=1S/C11H9ClF3N3OS/c12-8-2-1-7(5-16-8)6-18-3-4-20-10(18)17-9(19)11(13,14)15/h1-2,5H,3-4,6H2/b17-10- |
| InChIKey | DVBBNIYQXQOIFX-YVLHZVERSA-N |
| XLogP | 2.73 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.73 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|