C23H23N3O6 — CID 141280470
tert-butyl N-[[4-[3-[(6-nitro-3-pyridinyl)oxy]phenoxy]phenyl]methyl]carbamate (PubChem CID 141280470) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is tert-butyl N-[[4-[3-[(6-nitro-3-pyridinyl)oxy]phenoxy]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[3-[(6-nitro-3-pyridinyl)oxy]phenoxy]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 141280470 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | tert-butyl N-[[4-[3-[(6-nitro-3-pyridinyl)oxy]phenoxy]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(Oc2cccc(Oc3ccc([N+](=O)[O-])nc3)c2)cc1 |
| InChI | InChI=1S/C23H23N3O6/c1-23(2,3)32-22(27)25-14-16-7-9-17(10-8-16)30-18-5-4-6-19(13-18)31-20-11-12-21(24-15-20)26(28)29/h4-13,15H,14H2,1-3H3,(H,25,27) |
| InChIKey | LXGUWZIDNBUYKZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|