C8H14Br4O — CID 141280885
2,2,3,3-tetrabromooctan-1-ol (PubChem CID 141280885) has the molecular formula C8H14Br4O and a molecular weight of 445.82 g/mol. Its IUPAC name is 2,2,3,3-tetrabromooctan-1-ol.
| Compound Name | 2,2,3,3-tetrabromooctan-1-ol |
|---|---|
| PubChem CID | 141280885 |
| Molecular Formula | C8H14Br4O |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 441.78 |
| IUPAC Name | 2,2,3,3-tetrabromooctan-1-ol |
| SMILES | CCCCCC(Br)(Br)C(Br)(Br)CO |
| InChI | InChI=1S/C8H14Br4O/c1-2-3-4-5-7(9,10)8(11,12)6-13/h13H,2-6H2,1H3 |
| InChIKey | CXYDHSLRILXUOL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|