C9H12F10N2O4S2 — CID 141281448
bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;piperidin-1-ium (PubChem CID 141281448) has the molecular formula C9H12F10N2O4S2 and a molecular weight of 466.32 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;piperidin-1-ium.
| Compound Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;piperidin-1-ium |
|---|---|
| PubChem CID | 141281448 |
| Molecular Formula | C9H12F10N2O4S2 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;piperidin-1-ium |
| SMILES | C1CC[NH2+]CC1.O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H11N.C4F10NO4S2/c1-2-4-6-5-3-1;5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10/h6H,1-5H2;/q;-1/p+1 |
| InChIKey | YBELJTBFVVYNCR-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|