About cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate
cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 141282033) has the molecular formula C14H18O3
and a molecular weight of 234.29 g/mol. Its IUPAC name is cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate.
Molecular Properties
| Compound Name | cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
| PubChem CID | 141282033 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | O=C(OCC1=CCCCC1)C1=CC2OC2CC1 |
| InChI | InChI=1S/C14H18O3/c15-14(11-6-7-12-13(8-11)17-12)16-9-10-4-2-1-3-5-10/h4,8,12-13H,1-3,5-7,9H2 |
| InChIKey | ZTNHIJWURFVHCN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate?
The IUPAC name of cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate (CID 141282033) is cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate.
What is the SMILES notation for cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate?
The canonical SMILES for cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate is O=C(OCC1=CCCCC1)C1=CC2OC2CC1.
What is the InChIKey of cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate?
The InChIKey is ZTNHIJWURFVHCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c15-14(11-6-7-12-13(8-11)17-12)16-9-10-4-2-1-3-5-10/h4,8,12-13H,1-3,5-7,9H2.
What are the key properties of cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate?
cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate has a molecular weight of 234.29 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexen-1-ylmethyl 7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate is sourced from PubChem (CID 141282033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).