About [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea
[(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea (PubChem CID 141282510) has the molecular formula C18H19N3S2
and a molecular weight of 341.51 g/mol. Its IUPAC name is [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea.
Molecular Properties
| Compound Name | [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
| PubChem CID | 141282510 |
| Molecular Formula | C18H19N3S2 |
| Molecular Weight | 341.51 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
| SMILES | Cc1cccc2c1SCC(Cc1ccccc1)C2=NNC(N)=S |
| InChI | InChI=1S/C18H19N3S2/c1-12-6-5-9-15-16(20-21-18(19)22)14(11-23-17(12)15)10-13-7-3-2-4-8-13/h2-9,14H,10-11H2,1H3,(H3,19,21,22) |
| InChIKey | IPLRNNHCYRLKKV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
The IUPAC name of [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea (CID 141282510) is [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea.
What is the SMILES notation for [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
The canonical SMILES for [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea is Cc1cccc2c1SCC(Cc1ccccc1)C2=NNC(N)=S.
What is the InChIKey of [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
The InChIKey is IPLRNNHCYRLKKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3S2/c1-12-6-5-9-15-16(20-21-18(19)22)14(11-23-17(12)15)10-13-7-3-2-4-8-13/h2-9,14H,10-11H2,1H3,(H3,19,21,22).
What are the key properties of [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
[(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea has a molecular weight of 341.51 g/mol, XLogP of 3.50, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-benzyl-8-methyl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea is sourced from PubChem (CID 141282510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).