C17H20BrF3O4S — CID 141282885
4-[3-[4-bromo-2-(trifluoromethyl)phenyl]sulfonylcyclopentyl]oxyoxane (PubChem CID 141282885) has the molecular formula C17H20BrF3O4S and a molecular weight of 457.31 g/mol. Its IUPAC name is 4-[3-[4-bromo-2-(trifluoromethyl)phenyl]sulfonylcyclopentyl]oxyoxane.
| Compound Name | 4-[3-[4-bromo-2-(trifluoromethyl)phenyl]sulfonylcyclopentyl]oxyoxane |
|---|---|
| PubChem CID | 141282885 |
| Molecular Formula | C17H20BrF3O4S |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 4-[3-[4-bromo-2-(trifluoromethyl)phenyl]sulfonylcyclopentyl]oxyoxane |
| SMILES | O=S(=O)(c1ccc(Br)cc1C(F)(F)F)C1CCC(OC2CCOCC2)C1 |
| InChI | InChI=1S/C17H20BrF3O4S/c18-11-1-4-16(15(9-11)17(19,20)21)26(22,23)14-3-2-13(10-14)25-12-5-7-24-8-6-12/h1,4,9,12-14H,2-3,5-8,10H2 |
| InChIKey | RVPTVXFOMSVTOW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |