C18H18ClFN2O5S — CID 141282886
(1R,2R,4R)-4-(3-chloro-4-fluorophenyl)sulfonyl-2-(morpholine-4-carbonyl)cyclopentane-1-carbonyl cyanide (PubChem CID 141282886) has the molecular formula C18H18ClFN2O5S and a molecular weight of 428.87 g/mol. Its IUPAC name is (1R,2R,4R)-4-(3-chloro-4-fluorophenyl)sulfonyl-2-(morpholine-4-carbonyl)cyclopentane-1-carbonyl cyanide.
| Compound Name | (1R,2R,4R)-4-(3-chloro-4-fluorophenyl)sulfonyl-2-(morpholine-4-carbonyl)cyclopentane-1-carbonyl cyanide |
|---|---|
| PubChem CID | 141282886 |
| Molecular Formula | C18H18ClFN2O5S |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | (1R,2R,4R)-4-(3-chloro-4-fluorophenyl)sulfonyl-2-(morpholine-4-carbonyl)cyclopentane-1-carbonyl cyanide |
| SMILES | N#CC(=O)[C@@H]1C[C@@H](S(=O)(=O)c2ccc(F)c(Cl)c2)C[C@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H18ClFN2O5S/c19-15-9-11(1-2-16(15)20)28(25,26)12-7-13(17(23)10-21)14(8-12)18(24)22-3-5-27-6-4-22/h1-2,9,12-14H,3-8H2/t12-,13-,14-/m1/s1 |
| InChIKey | HAJGTSWXGIBKII-MGPQQGTHSA-N |
| XLogP | 1.60 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|