About [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate
[(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate (PubChem CID 141284032) has the molecular formula C13H16FNO2
and a molecular weight of 237.27 g/mol. Its IUPAC name is [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate.
Molecular Properties
| Compound Name | [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate |
| PubChem CID | 141284032 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCN[C@@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C13H16FNO2/c1-9(16)17-12-6-7-15-13(8-12)10-2-4-11(14)5-3-10/h2-5,12-13,15H,6-8H2,1H3/t12-,13-/m1/s1 |
| InChIKey | PLQYPVVHJWSSQU-CHWSQXEVSA-N |
| XLogP | 2.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate?
The IUPAC name of [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate (CID 141284032) is [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate.
What is the SMILES notation for [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate?
The canonical SMILES for [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate is CC(=O)O[C@@H]1CCN[C@@H](c2ccc(F)cc2)C1.
What is the InChIKey of [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate?
The InChIKey is PLQYPVVHJWSSQU-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H16FNO2/c1-9(16)17-12-6-7-15-13(8-12)10-2-4-11(14)5-3-10/h2-5,12-13,15H,6-8H2,1H3/t12-,13-/m1/s1.
What are the key properties of [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate?
[(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate has a molecular weight of 237.27 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4R)-2-(4-fluorophenyl)piperidin-4-yl] acetate is sourced from PubChem (CID 141284032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).