About bis(10-methylundecyl) 2-ethylhexanedioate
bis(10-methylundecyl) 2-ethylhexanedioate (PubChem CID 141285413) has the molecular formula C32H62O4
and a molecular weight of 510.84 g/mol. Its IUPAC name is bis(10-methylundecyl) 2-ethylhexanedioate.
Molecular Properties
| Compound Name | bis(10-methylundecyl) 2-ethylhexanedioate |
| PubChem CID | 141285413 |
| Molecular Formula | C32H62O4 |
| Molecular Weight | 510.84 g/mol |
| Exact Mass | 510.46 |
| IUPAC Name | bis(10-methylundecyl) 2-ethylhexanedioate |
| SMILES | CCC(CCCC(=O)OCCCCCCCCCC(C)C)C(=O)OCCCCCCCCCC(C)C |
| InChI | InChI=1S/C32H62O4/c1-6-30(32(34)36-27-20-16-12-8-10-14-18-23-29(4)5)24-21-25-31(33)35-26-19-15-11-7-9-13-17-22-28(2)3/h28-30H,6-27H2,1-5H3 |
| InChIKey | DIKGUEGKAUKOEQ-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.84 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(10-methylundecyl) 2-ethylhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(10-methylundecyl) 2-ethylhexanedioate?
The IUPAC name of bis(10-methylundecyl) 2-ethylhexanedioate (CID 141285413) is bis(10-methylundecyl) 2-ethylhexanedioate.
What is the SMILES notation for bis(10-methylundecyl) 2-ethylhexanedioate?
The canonical SMILES for bis(10-methylundecyl) 2-ethylhexanedioate is CCC(CCCC(=O)OCCCCCCCCCC(C)C)C(=O)OCCCCCCCCCC(C)C.
What is the InChIKey of bis(10-methylundecyl) 2-ethylhexanedioate?
The InChIKey is DIKGUEGKAUKOEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H62O4/c1-6-30(32(34)36-27-20-16-12-8-10-14-18-23-29(4)5)24-21-25-31(33)35-26-19-15-11-7-9-13-17-22-28(2)3/h28-30H,6-27H2,1-5H3.
What are the key properties of bis(10-methylundecyl) 2-ethylhexanedioate?
bis(10-methylundecyl) 2-ethylhexanedioate has a molecular weight of 510.84 g/mol, XLogP of 9.82, 26 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(10-methylundecyl) 2-ethylhexanedioate is sourced from PubChem (CID 141285413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).