About 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol
6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol (PubChem CID 141285451) has the molecular formula C14H15N3O3
and a molecular weight of 273.29 g/mol. Its IUPAC name is 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol.
Molecular Properties
| Compound Name | 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol |
| PubChem CID | 141285451 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol |
| SMILES | OCCC1=CC(n2nc3ccccc3n2)C(O)(O)C=C1 |
| InChI | InChI=1S/C14H15N3O3/c18-8-6-10-5-7-14(19,20)13(9-10)17-15-11-3-1-2-4-12(11)16-17/h1-5,7,9,13,18-20H,6,8H2 |
| InChIKey | BUPYGQJXZBIQTE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol?
The IUPAC name of 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol (CID 141285451) is 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol.
What is the SMILES notation for 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol?
The canonical SMILES for 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol is OCCC1=CC(n2nc3ccccc3n2)C(O)(O)C=C1.
What is the InChIKey of 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol?
The InChIKey is BUPYGQJXZBIQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O3/c18-8-6-10-5-7-14(19,20)13(9-10)17-15-11-3-1-2-4-12(11)16-17/h1-5,7,9,13,18-20H,6,8H2.
What are the key properties of 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol?
6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol has a molecular weight of 273.29 g/mol, XLogP of 0.53, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(benzotriazol-2-yl)-4-(2-hydroxyethyl)cyclohexa-2,4-diene-1,1-diol is sourced from PubChem (CID 141285451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).