C22H20ClN3 — CID 141285603
3-[6-chloro-1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 141285603) has the molecular formula C22H20ClN3 and a molecular weight of 361.88 g/mol. Its IUPAC name is 3-[6-chloro-1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[6-chloro-1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 141285603 |
| Molecular Formula | C22H20ClN3 |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-[6-chloro-1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2H-pyridin-4-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | ClC1=CC(c2c[nH]c3ncccc23)=CCN1c1cccc2c1CCCC2 |
| InChI | InChI=1S/C22H20ClN3/c23-21-13-16(19-14-25-22-18(19)8-4-11-24-22)10-12-26(21)20-9-3-6-15-5-1-2-7-17(15)20/h3-4,6,8-11,13-14H,1-2,5,7,12H2,(H,24,25) |
| InChIKey | WQOICUSIWDDIBC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|