C7H10F5NO3 — CID 141285831
2,2,3,3,3-pentafluoropropyl N-(2-methoxyethyl)carbamate (PubChem CID 141285831) has the molecular formula C7H10F5NO3 and a molecular weight of 251.15 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl N-(2-methoxyethyl)carbamate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 141285831 |
| Molecular Formula | C7H10F5NO3 |
| Molecular Weight | 251.15 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F5NO3/c1-15-3-2-13-5(14)16-4-6(8,9)7(10,11)12/h2-4H2,1H3,(H,13,14) |
| InChIKey | PZHGAXVWISMPLM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.15 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|