C15H24O9 — CID 141285998
[(2R,3R,4S,5S)-5-acetyl-3,4,5-trihydroxy-1-methoxy-3,4-dimethyl-6,7-dioxooctan-2-yl] acetate (PubChem CID 141285998) has the molecular formula C15H24O9 and a molecular weight of 348.35 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-5-acetyl-3,4,5-trihydroxy-1-methoxy-3,4-dimethyl-6,7-dioxooctan-2-yl] acetate.
| Compound Name | [(2R,3R,4S,5S)-5-acetyl-3,4,5-trihydroxy-1-methoxy-3,4-dimethyl-6,7-dioxooctan-2-yl] acetate |
|---|---|
| PubChem CID | 141285998 |
| Molecular Formula | C15H24O9 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [(2R,3R,4S,5S)-5-acetyl-3,4,5-trihydroxy-1-methoxy-3,4-dimethyl-6,7-dioxooctan-2-yl] acetate |
| SMILES | COC[C@@H](OC(C)=O)[C@@](C)(O)[C@](C)(O)[C@](O)(C(C)=O)C(=O)C(C)=O |
| InChI | InChI=1S/C15H24O9/c1-8(16)12(19)15(22,9(2)17)14(5,21)13(4,20)11(7-23-6)24-10(3)18/h11,20-22H,7H2,1-6H3/t11-,13-,14+,15+/m1/s1 |
| InChIKey | CNEWXZKPQRGCHT-RZFFKMDDSA-N |
| XLogP | -1.46 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|