C12H14ClN7O — CID 141286274
(3R,4R)-4-azido-1-[(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)methyl]piperidin-3-ol (PubChem CID 141286274) has the molecular formula C12H14ClN7O and a molecular weight of 307.75 g/mol. Its IUPAC name is (3R,4R)-4-azido-1-[(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)methyl]piperidin-3-ol.
| Compound Name | (3R,4R)-4-azido-1-[(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 141286274 |
| Molecular Formula | C12H14ClN7O |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | (3R,4R)-4-azido-1-[(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)methyl]piperidin-3-ol |
| SMILES | [N-]=[N+]=N[C@@H]1CCN(Cc2c[nH]c3ncnc(Cl)c23)C[C@H]1O |
| InChI | InChI=1S/C12H14ClN7O/c13-11-10-7(3-15-12(10)17-6-16-11)4-20-2-1-8(18-19-14)9(21)5-20/h3,6,8-9,21H,1-2,4-5H2,(H,15,16,17)/t8-,9-/m1/s1 |
| InChIKey | FLKKVGKFEVKEDF-RKDXNWHRSA-N |
| XLogP | 1.86 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|