About cyclohexene-1-sulfonate;4-methylmorpholin-4-ium
cyclohexene-1-sulfonate;4-methylmorpholin-4-ium (PubChem CID 141286423) has the molecular formula C11H21NO4S
and a molecular weight of 263.36 g/mol. Its IUPAC name is cyclohexene-1-sulfonate;4-methylmorpholin-4-ium.
Molecular Properties
| Compound Name | cyclohexene-1-sulfonate;4-methylmorpholin-4-ium |
| PubChem CID | 141286423 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | cyclohexene-1-sulfonate;4-methylmorpholin-4-ium |
| SMILES | C[NH+]1CCOCC1.O=S(=O)([O-])C1=CCCCC1 |
| InChI | InChI=1S/C6H10O3S.C5H11NO/c7-10(8,9)6-4-2-1-3-5-6;1-6-2-4-7-5-3-6/h4H,1-3,5H2,(H,7,8,9);2-5H2,1H3 |
| InChIKey | PYBNYOLWPXZGTM-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 70.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexene-1-sulfonate;4-methylmorpholin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexene-1-sulfonate;4-methylmorpholin-4-ium?
The IUPAC name of cyclohexene-1-sulfonate;4-methylmorpholin-4-ium (CID 141286423) is cyclohexene-1-sulfonate;4-methylmorpholin-4-ium.
What is the SMILES notation for cyclohexene-1-sulfonate;4-methylmorpholin-4-ium?
The canonical SMILES for cyclohexene-1-sulfonate;4-methylmorpholin-4-ium is C[NH+]1CCOCC1.O=S(=O)([O-])C1=CCCCC1.
What is the InChIKey of cyclohexene-1-sulfonate;4-methylmorpholin-4-ium?
The InChIKey is PYBNYOLWPXZGTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3S.C5H11NO/c7-10(8,9)6-4-2-1-3-5-6;1-6-2-4-7-5-3-6/h4H,1-3,5H2,(H,7,8,9);2-5H2,1H3.
What are the key properties of cyclohexene-1-sulfonate;4-methylmorpholin-4-ium?
cyclohexene-1-sulfonate;4-methylmorpholin-4-ium has a molecular weight of 263.36 g/mol, XLogP of -0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexene-1-sulfonate;4-methylmorpholin-4-ium is sourced from PubChem (CID 141286423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).