About 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine
2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine (PubChem CID 141286843) has the molecular formula C12H14BrIN2
and a molecular weight of 393.07 g/mol. Its IUPAC name is 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine |
| PubChem CID | 141286843 |
| Molecular Formula | C12H14BrIN2 |
| Molecular Weight | 393.07 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine |
| SMILES | CCC(Br)C1=C(I)CN2C(C)=CC=CC2=N1 |
| InChI | InChI=1S/C12H14BrIN2/c1-3-9(13)12-10(14)7-16-8(2)5-4-6-11(16)15-12/h4-6,9H,3,7H2,1-2H3 |
| InChIKey | PXVORFBMHWQONI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.07 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine?
The IUPAC name of 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine (CID 141286843) is 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine.
What is the SMILES notation for 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine?
The canonical SMILES for 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine is CCC(Br)C1=C(I)CN2C(C)=CC=CC2=N1.
What is the InChIKey of 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine?
The InChIKey is PXVORFBMHWQONI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrIN2/c1-3-9(13)12-10(14)7-16-8(2)5-4-6-11(16)15-12/h4-6,9H,3,7H2,1-2H3.
What are the key properties of 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine?
2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine has a molecular weight of 393.07 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-bromopropyl)-3-iodo-6-methyl-4H-pyrido[1,2-a]pyrimidine is sourced from PubChem (CID 141286843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).