C9H12N2O — CID 141286933
2,3,4,4a,5,7-hexahydro-1H-pyrano[4,3-b]pyridine-3-carbonitrile (PubChem CID 141286933) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 2,3,4,4a,5,7-hexahydro-1H-pyrano[4,3-b]pyridine-3-carbonitrile.
| Compound Name | 2,3,4,4a,5,7-hexahydro-1H-pyrano[4,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 141286933 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2,3,4,4a,5,7-hexahydro-1H-pyrano[4,3-b]pyridine-3-carbonitrile |
| SMILES | N#CC1CNC2=CCOCC2C1 |
| InChI | InChI=1S/C9H12N2O/c10-4-7-3-8-6-12-2-1-9(8)11-5-7/h1,7-8,11H,2-3,5-6H2 |
| InChIKey | QNMJQZCYFLOGRS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |