About (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid
(3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid (PubChem CID 141287005) has the molecular formula C10H15NO6
and a molecular weight of 245.23 g/mol. Its IUPAC name is (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid |
| PubChem CID | 141287005 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid |
| SMILES | COC(=O)[C@@H]1CC2(CN1C(=O)O)OCCCO2 |
| InChI | InChI=1S/C10H15NO6/c1-15-8(12)7-5-10(6-11(7)9(13)14)16-3-2-4-17-10/h7H,2-6H2,1H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | KXRWDDZFULISPI-ZETCQYMHSA-N |
| XLogP | 0.04 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid?
The IUPAC name of (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid (CID 141287005) is (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid.
What is the SMILES notation for (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid?
The canonical SMILES for (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid is COC(=O)[C@@H]1CC2(CN1C(=O)O)OCCCO2.
What is the InChIKey of (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid?
The InChIKey is KXRWDDZFULISPI-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H15NO6/c1-15-8(12)7-5-10(6-11(7)9(13)14)16-3-2-4-17-10/h7H,2-6H2,1H3,(H,13,14)/t7-/m0/s1.
What are the key properties of (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid?
(3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid has a molecular weight of 245.23 g/mol, XLogP of 0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methoxycarbonyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carboxylic acid is sourced from PubChem (CID 141287005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).