About 5-(1,2,4-triazol-4-yl)pyrimidine
5-(1,2,4-triazol-4-yl)pyrimidine (PubChem CID 141287053) has the molecular formula C6H5N5
and a molecular weight of 147.14 g/mol. Its IUPAC name is 5-(1,2,4-triazol-4-yl)pyrimidine.
Molecular Properties
| Compound Name | 5-(1,2,4-triazol-4-yl)pyrimidine |
| PubChem CID | 141287053 |
| Molecular Formula | C6H5N5 |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 5-(1,2,4-triazol-4-yl)pyrimidine |
| SMILES | c1ncc(-n2cnnc2)cn1 |
| InChI | InChI=1S/C6H5N5/c1-6(2-8-3-7-1)11-4-9-10-5-11/h1-5H |
| InChIKey | BOBCPNZXKMZKIU-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1,2,4-triazol-4-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2,4-triazol-4-yl)pyrimidine?
The IUPAC name of 5-(1,2,4-triazol-4-yl)pyrimidine (CID 141287053) is 5-(1,2,4-triazol-4-yl)pyrimidine.
What is the SMILES notation for 5-(1,2,4-triazol-4-yl)pyrimidine?
The canonical SMILES for 5-(1,2,4-triazol-4-yl)pyrimidine is c1ncc(-n2cnnc2)cn1.
What is the InChIKey of 5-(1,2,4-triazol-4-yl)pyrimidine?
The InChIKey is BOBCPNZXKMZKIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5/c1-6(2-8-3-7-1)11-4-9-10-5-11/h1-5H.
What are the key properties of 5-(1,2,4-triazol-4-yl)pyrimidine?
5-(1,2,4-triazol-4-yl)pyrimidine has a molecular weight of 147.14 g/mol, XLogP of 0.06, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2,4-triazol-4-yl)pyrimidine is sourced from PubChem (CID 141287053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).