About pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide
pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide (PubChem CID 141287209) has the molecular formula C5H10BF6N
and a molecular weight of 208.94 g/mol. Its IUPAC name is pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide.
Molecular Properties
| Compound Name | pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide |
| PubChem CID | 141287209 |
| Molecular Formula | C5H10BF6N |
| Molecular Weight | 208.94 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide |
| SMILES | C1CC[NH2+]C1.F[B-](F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H9N.CBF6/c1-2-4-5-3-1;3-1(4,5)2(6,7)8/h5H,1-4H2;/q;-1/p+1 |
| InChIKey | HIUHOHOSYCBTCT-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.94 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide?
The IUPAC name of pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide (CID 141287209) is pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide.
What is the SMILES notation for pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide?
The canonical SMILES for pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide is C1CC[NH2+]C1.F[B-](F)(F)C(F)(F)F.
What is the InChIKey of pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide?
The InChIKey is HIUHOHOSYCBTCT-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H9N.CBF6/c1-2-4-5-3-1;3-1(4,5)2(6,7)8/h5H,1-4H2;/q;-1/p+1.
What are the key properties of pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide?
pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide has a molecular weight of 208.94 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-ium;trifluoro(trifluoromethyl)boranuide is sourced from PubChem (CID 141287209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).