C9H16BF8NO — CID 141287215
1-(methoxymethyl)-1-methylpyrrolidin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide (PubChem CID 141287215) has the molecular formula C9H16BF8NO and a molecular weight of 317.03 g/mol. Its IUPAC name is 1-(methoxymethyl)-1-methylpyrrolidin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide.
| Compound Name | 1-(methoxymethyl)-1-methylpyrrolidin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
|---|---|
| PubChem CID | 141287215 |
| Molecular Formula | C9H16BF8NO |
| Molecular Weight | 317.03 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-(methoxymethyl)-1-methylpyrrolidin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
| SMILES | COC[N+]1(C)CCCC1.F[B-](F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H16NO.C2BF8/c1-8(7-9-2)5-3-4-6-8;4-1(5,2(6,7)8)3(9,10)11/h3-7H2,1-2H3;/q+1;-1 |
| InChIKey | JQAUCDDSGMEHFO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.03 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|