C9H10FN5O — CID 141287446
2-[4-[(5-fluoropyrimidin-2-yl)amino]pyrazol-1-yl]ethanol (PubChem CID 141287446) has the molecular formula C9H10FN5O and a molecular weight of 223.21 g/mol. Its IUPAC name is 2-[4-[(5-fluoropyrimidin-2-yl)amino]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[(5-fluoropyrimidin-2-yl)amino]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 141287446 |
| Molecular Formula | C9H10FN5O |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-[4-[(5-fluoropyrimidin-2-yl)amino]pyrazol-1-yl]ethanol |
| SMILES | OCCn1cc(Nc2ncc(F)cn2)cn1 |
| InChI | InChI=1S/C9H10FN5O/c10-7-3-11-9(12-4-7)14-8-5-13-15(6-8)1-2-16/h3-6,16H,1-2H2,(H,11,12,14) |
| InChIKey | GVNPXOMXGUJMSW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |