C30H26N4O2S — CID 141287524
N-[2-[4-(N-phenylanilino)phenyl]-1-pyridin-2-ylethyl]pyridine-3-sulfonamide (PubChem CID 141287524) has the molecular formula C30H26N4O2S and a molecular weight of 506.63 g/mol. Its IUPAC name is N-[2-[4-(N-phenylanilino)phenyl]-1-pyridin-2-ylethyl]pyridine-3-sulfonamide.
| Compound Name | N-[2-[4-(N-phenylanilino)phenyl]-1-pyridin-2-ylethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 141287524 |
| Molecular Formula | C30H26N4O2S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | N-[2-[4-(N-phenylanilino)phenyl]-1-pyridin-2-ylethyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC(Cc1ccc(N(c2ccccc2)c2ccccc2)cc1)c1ccccn1)c1cccnc1 |
| InChI | InChI=1S/C30H26N4O2S/c35-37(36,28-14-9-20-31-23-28)33-30(29-15-7-8-21-32-29)22-24-16-18-27(19-17-24)34(25-10-3-1-4-11-25)26-12-5-2-6-13-26/h1-21,23,30,33H,22H2 |
| InChIKey | TYSTVCGLDUVGHU-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |