About 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride
3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride (PubChem CID 141287965) has the molecular formula C9H10ClO6P
and a molecular weight of 280.60 g/mol. Its IUPAC name is 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride.
Molecular Properties
| Compound Name | 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride |
| PubChem CID | 141287965 |
| Molecular Formula | C9H10ClO6P |
| Molecular Weight | 280.60 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride |
| SMILES | Cl.O=C=CCOP(=O)(CC=C=O)OCC=C=O |
| InChI | InChI=1S/C9H9O6P.ClH/c10-4-1-7-14-16(13,9-3-6-12)15-8-2-5-11;/h1-3H,7-9H2;1H |
| InChIKey | FKBNFIZKPQNQNU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.60 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride?
The IUPAC name of 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride (CID 141287965) is 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride.
What is the SMILES notation for 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride?
The canonical SMILES for 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride is Cl.O=C=CCOP(=O)(CC=C=O)OCC=C=O.
What is the InChIKey of 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride?
The InChIKey is FKBNFIZKPQNQNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9O6P.ClH/c10-4-1-7-14-16(13,9-3-6-12)15-8-2-5-11;/h1-3H,7-9H2;1H.
What are the key properties of 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride?
3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride has a molecular weight of 280.60 g/mol, XLogP of 0.80, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-oxoprop-2-enoxy(3-oxoprop-2-enyl)phosphoryl]oxyprop-1-en-1-one;hydrochloride is sourced from PubChem (CID 141287965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).