About 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride
3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride (PubChem CID 141287967) has the molecular formula C6H12Cl2F2N2
and a molecular weight of 221.08 g/mol. Its IUPAC name is 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride.
Molecular Properties
| Compound Name | 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride |
| PubChem CID | 141287967 |
| Molecular Formula | C6H12Cl2F2N2 |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride |
| SMILES | Cl.Cl.FC1(F)CNC12CCNC2 |
| InChI | InChI=1S/C6H10F2N2.2ClH/c7-6(8)4-10-5(6)1-2-9-3-5;;/h9-10H,1-4H2;2*1H |
| InChIKey | YYURGOXXHFXNDA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride?
The IUPAC name of 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride (CID 141287967) is 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride.
What is the SMILES notation for 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride?
The canonical SMILES for 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride is Cl.Cl.FC1(F)CNC12CCNC2.
What is the InChIKey of 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride?
The InChIKey is YYURGOXXHFXNDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2N2.2ClH/c7-6(8)4-10-5(6)1-2-9-3-5;;/h9-10H,1-4H2;2*1H.
What are the key properties of 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride?
3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride has a molecular weight of 221.08 g/mol, XLogP of 0.80, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1,7-diazaspiro[3.4]octane;dihydrochloride is sourced from PubChem (CID 141287967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).