About [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane
[2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane (PubChem CID 141289269) has the molecular formula C21H24Cl2Si
and a molecular weight of 375.42 g/mol. Its IUPAC name is [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane.
Molecular Properties
| Compound Name | [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane |
| PubChem CID | 141289269 |
| Molecular Formula | C21H24Cl2Si |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane |
| SMILES | CCC1=CC2=CC=CCC(c3cc(Cl)c([Si](C)(C)C)c(Cl)c3)C2=C1 |
| InChI | InChI=1S/C21H24Cl2Si/c1-5-14-10-15-8-6-7-9-17(18(15)11-14)16-12-19(22)21(20(23)13-16)24(2,3)4/h6-8,10-13,17H,5,9H2,1-4H3 |
| InChIKey | OQRGZSZDTQQXKM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane?
The IUPAC name of [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane (CID 141289269) is [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane.
What is the SMILES notation for [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane?
The canonical SMILES for [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane is CCC1=CC2=CC=CCC(c3cc(Cl)c([Si](C)(C)C)c(Cl)c3)C2=C1.
What is the InChIKey of [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane?
The InChIKey is OQRGZSZDTQQXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24Cl2Si/c1-5-14-10-15-8-6-7-9-17(18(15)11-14)16-12-19(22)21(20(23)13-16)24(2,3)4/h6-8,10-13,17H,5,9H2,1-4H3.
What are the key properties of [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane?
[2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane has a molecular weight of 375.42 g/mol, XLogP of 6.78, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dichloro-4-(2-ethyl-4,5-dihydroazulen-4-yl)phenyl]-trimethylsilane is sourced from PubChem (CID 141289269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).