(2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid

C13H10BNO2S — CID 141289408

IUPAC(2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid
SMILESOB(O)c1ccccc1-c1cnc2cccc-2s1
InChIInChI=1S/C13H10BNO2S/c16-14(17)10-5-2-1-4-9(10)13-8-15-11-6-3-7-12(11)18-13/h1-8,16-17H
InChIKeyHBHJWGWSVOVQNE-UHFFFAOYSA-N
MW255.11 g/mol
LogP1.59
Rot. Bonds2

About (2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid

(2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid (PubChem CID 141289408) has the molecular formula C13H10BNO2S and a molecular weight of 255.11 g/mol. Its IUPAC name is (2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid.

Molecular Properties

Compound Name(2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid
PubChem CID141289408
Molecular FormulaC13H10BNO2S
Molecular Weight255.11 g/mol
Exact Mass255.05
IUPAC Name(2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid
SMILESOB(O)c1ccccc1-c1cnc2cccc-2s1
InChIInChI=1S/C13H10BNO2S/c16-14(17)10-5-2-1-4-9(10)13-8-15-11-6-3-7-12(11)18-13/h1-8,16-17H
InChIKeyHBHJWGWSVOVQNE-UHFFFAOYSA-N
XLogP1.59
TPSA53.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.11
LogP ≤ 51.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid?
The IUPAC name of (2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid (CID 141289408) is (2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid.
What is the SMILES notation for (2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid?
The canonical SMILES for (2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid is OB(O)c1ccccc1-c1cnc2cccc-2s1.
What is the InChIKey of (2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid?
The InChIKey is HBHJWGWSVOVQNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BNO2S/c16-14(17)10-5-2-1-4-9(10)13-8-15-11-6-3-7-12(11)18-13/h1-8,16-17H.
What are the key properties of (2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid?
(2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid has a molecular weight of 255.11 g/mol, XLogP of 1.59, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopenta[b][1,4]thiazin-2-ylphenyl)boronic acid is sourced from PubChem (CID 141289408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).