C13H7Br6N — CID 141289541
bis(2,4,6-tribromophenyl)methanamine (PubChem CID 141289541) has the molecular formula C13H7Br6N and a molecular weight of 656.63 g/mol. Its IUPAC name is bis(2,4,6-tribromophenyl)methanamine.
| Compound Name | bis(2,4,6-tribromophenyl)methanamine |
|---|---|
| PubChem CID | 141289541 |
| Molecular Formula | C13H7Br6N |
| Molecular Weight | 656.63 g/mol |
| Exact Mass | 650.57 |
| IUPAC Name | bis(2,4,6-tribromophenyl)methanamine |
| SMILES | NC(c1c(Br)cc(Br)cc1Br)c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C13H7Br6N/c14-5-1-7(16)11(8(17)2-5)13(20)12-9(18)3-6(15)4-10(12)19/h1-4,13H,20H2 |
| InChIKey | WXLKJBBJKYAJRA-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.63 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |