About 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate
6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate (PubChem CID 141289628) has the molecular formula C42H69AlO12
and a molecular weight of 792.98 g/mol. Its IUPAC name is 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate.
Molecular Properties
| Compound Name | 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate |
| PubChem CID | 141289628 |
| Molecular Formula | C42H69AlO12 |
| Molecular Weight | 792.98 g/mol |
| Exact Mass | 792.46 |
| IUPAC Name | 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate |
| SMILES | CCCCCCC=COC(=O)CCCCC(=O)O[Al](OC(=O)CCCCC(=O)OC=CCCCCCC)OC(=O)CCCCC(=O)OC=CCCCCCC |
| InChI | InChI=1S/3C14H24O4.Al/c3*1-2-3-4-5-6-9-12-18-14(17)11-8-7-10-13(15)16;/h3*9,12H,2-8,10-11H2,1H3,(H,15,16);/q;;;+3/p-3 |
| InChIKey | DXRHMUKBXVANGT-UHFFFAOYSA-K |
| XLogP | 10.36 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 792.98 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate?
The IUPAC name of 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate (CID 141289628) is 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate.
What is the SMILES notation for 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate?
The canonical SMILES for 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate is CCCCCCC=COC(=O)CCCCC(=O)O[Al](OC(=O)CCCCC(=O)OC=CCCCCCC)OC(=O)CCCCC(=O)OC=CCCCCCC.
What is the InChIKey of 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate?
The InChIKey is DXRHMUKBXVANGT-UHFFFAOYSA-K. The full InChI is InChI=1S/3C14H24O4.Al/c3*1-2-3-4-5-6-9-12-18-14(17)11-8-7-10-13(15)16;/h3*9,12H,2-8,10-11H2,1H3,(H,15,16);/q;;;+3/p-3.
What are the key properties of 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate?
6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate has a molecular weight of 792.98 g/mol, XLogP of 10.36, 36 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-bis[(6-oct-1-enoxy-6-oxohexanoyl)oxy]alumanyl 1-O-oct-1-enyl hexanedioate is sourced from PubChem (CID 141289628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).