C9H13F2N5 — CID 141289874
5-(2,2-difluoroethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-diamine (PubChem CID 141289874) has the molecular formula C9H13F2N5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-diamine.
| Compound Name | 5-(2,2-difluoroethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141289874 |
| Molecular Formula | C9H13F2N5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 5-(2,2-difluoroethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c2c(n1)CCNC2CC(F)F |
| InChI | InChI=1S/C9H13F2N5/c10-6(11)3-5-7-4(1-2-14-5)15-9(13)16-8(7)12/h5-6,14H,1-3H2,(H4,12,13,15,16) |
| InChIKey | ZLEXCHXLIKSBBT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |