C18H21ClN4O3 — CID 141290215
1-(2-chloro-4-nitroimidazol-1-yl)-6-(3H-indol-3-yl)-2-methylhexan-2-ol (PubChem CID 141290215) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is 1-(2-chloro-4-nitroimidazol-1-yl)-6-(3H-indol-3-yl)-2-methylhexan-2-ol.
| Compound Name | 1-(2-chloro-4-nitroimidazol-1-yl)-6-(3H-indol-3-yl)-2-methylhexan-2-ol |
|---|---|
| PubChem CID | 141290215 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 1-(2-chloro-4-nitroimidazol-1-yl)-6-(3H-indol-3-yl)-2-methylhexan-2-ol |
| SMILES | CC(O)(CCCCC1C=Nc2ccccc21)Cn1cc([N+](=O)[O-])nc1Cl |
| InChI | InChI=1S/C18H21ClN4O3/c1-18(24,12-22-11-16(23(25)26)21-17(22)19)9-5-4-6-13-10-20-15-8-3-2-7-14(13)15/h2-3,7-8,10-11,13,24H,4-6,9,12H2,1H3 |
| InChIKey | QYACNIQQFGWSFY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|