C28H24O9 — CID 141290603
(3R,4R,5S)-4,5-dibenzoyl-2,3,4,5-tetrahydroxy-1-phenyloctane-1,6,7-trione (PubChem CID 141290603) has the molecular formula C28H24O9 and a molecular weight of 504.49 g/mol. Its IUPAC name is (3R,4R,5S)-4,5-dibenzoyl-2,3,4,5-tetrahydroxy-1-phenyloctane-1,6,7-trione.
| Compound Name | (3R,4R,5S)-4,5-dibenzoyl-2,3,4,5-tetrahydroxy-1-phenyloctane-1,6,7-trione |
|---|---|
| PubChem CID | 141290603 |
| Molecular Formula | C28H24O9 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | (3R,4R,5S)-4,5-dibenzoyl-2,3,4,5-tetrahydroxy-1-phenyloctane-1,6,7-trione |
| SMILES | CC(=O)C(=O)[C@@](O)(C(=O)c1ccccc1)[C@@](O)(C(=O)c1ccccc1)[C@H](O)C(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H24O9/c1-17(29)23(32)27(36,24(33)19-13-7-3-8-14-19)28(37,25(34)20-15-9-4-10-16-20)26(35)22(31)21(30)18-11-5-2-6-12-18/h2-16,22,26,31,35-37H,1H3/t22?,26-,27-,28-/m1/s1 |
| InChIKey | JKBRCYHNTCMICZ-ZQCUGPNOSA-N |
| XLogP | 0.98 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|