About 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one
6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one (PubChem CID 141290778) has the molecular formula C9H10BrNO
and a molecular weight of 228.09 g/mol. Its IUPAC name is 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one.
Molecular Properties
| Compound Name | 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one |
| PubChem CID | 141290778 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one |
| SMILES | CN1C(=O)CC2CC=C(Br)C=C21 |
| InChI | InChI=1S/C9H10BrNO/c1-11-8-5-7(10)3-2-6(8)4-9(11)12/h3,5-6H,2,4H2,1H3 |
| InChIKey | QFVUQJINNCCMOG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one?
The IUPAC name of 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one (CID 141290778) is 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one.
What is the SMILES notation for 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one?
The canonical SMILES for 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one is CN1C(=O)CC2CC=C(Br)C=C21.
What is the InChIKey of 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one?
The InChIKey is QFVUQJINNCCMOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO/c1-11-8-5-7(10)3-2-6(8)4-9(11)12/h3,5-6H,2,4H2,1H3.
What are the key properties of 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one?
6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one has a molecular weight of 228.09 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-methyl-3a,4-dihydro-3H-indol-2-one is sourced from PubChem (CID 141290778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).